Products 105355-25-7

CAS 105355-25-7 is the registry number for Methyl 2-bromo-3-(4-(2-(5-ethylpyridin-2-yl)ethoxy)phenyl)propanoate 95+%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoate (CAS 105355-25-7) is a chemical compound with the molecular formula C19H22BrNO3 and a molecular weight of 392.3 g/mol. IUPAC name: methyl 2-bromo-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoate. InChIKey: CJQRUDWOZDEKKO-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22BrNO3
Molecular weight392.3 g/mol
IUPAC namemethyl 2-bromo-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoate
InChIKeyCJQRUDWOZDEKKO-UHFFFAOYSA-N
SMILESCCC1=CN=C(C=C1)CCOC2=CC=C(C=C2)CC(C(=O)OC)Br

Computed by PubChem (NCBI)