CAS 1053658-51-7 appears in our catalog under these names: 2-Chloro-4-(3-fluorophenyl)-1,3,5-triazine, 95%, 2-Chloro-4-(3-fluorophenyl)-1,3,5-triazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-4-(3-fluorophenyl)-1,3,5-triazine (CAS 1053658-51-7) is a chemical compound with the molecular formula C9H5ClFN3 and a molecular weight of 209.61 g/mol. IUPAC name: 2-chloro-4-(3-fluorophenyl)-1,3,5-triazine. InChIKey: REIFUUDEOYACDL-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN3 |
|---|---|
| Molecular weight | 209.61 g/mol |
| IUPAC name | 2-chloro-4-(3-fluorophenyl)-1,3,5-triazine |
| InChIKey | REIFUUDEOYACDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=NC=N2)Cl |
Computed by PubChem (NCBI)