CAS 105383-68-4 appears in our catalog under these names: Methyl 4-(2,3-Dichlorophenyl)-2,6-dimethylnicotinate, Methyl 4-(2,3-dichlorophenyl)-2,6-dimethylnicotinate, 95%, Clevidipine Impurity 8, Clevidipine Impurity J. Offered by: TRC, Chemat Brand, Hubei YoungXin. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 200mg.
Methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3-carboxylate (CAS 105383-68-4) is a chemical compound with the molecular formula C15H13Cl2NO2 and a molecular weight of 310.2 g/mol. IUPAC name: methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3-carboxylate. InChIKey: HKJISOWPZVBGRK-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO2 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3-carboxylate |
| InChIKey | HKJISOWPZVBGRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)