CAS 1053960-15-8 appears in our catalog under these names: 2-{4-((3-chlorophenyl)methyl)piperazin-1-yl}pyridine-3-carboxylic acid, 95%, 2-{4-((3-Chlorophenyl)methyl)piperazin-1-yl}pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]pyridine-3-carboxylic acid (CAS 1053960-15-8) is a chemical compound with the molecular formula C17H18ClN3O2 and a molecular weight of 331.8 g/mol. IUPAC name: 2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]pyridine-3-carboxylic acid. InChIKey: LUWYSIYXLZHYHW-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O2 |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]pyridine-3-carboxylic acid |
| InChIKey | LUWYSIYXLZHYHW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC(=CC=C2)Cl)C3=C(C=CC=N3)C(=O)O |
Computed by PubChem (NCBI)