CAS 105404-91-9 appears in our catalog under these names: 2,8-Diiododibenzothiophene, 95%, 2,8–Diiododibenzo–thiophene, 2,8-Diiododibenzothiophene, >97.0%(GC), 2,8-Diiododibenzothiophene 97%, 2,8-Diiododibenzothiophene, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 200mg, 1g, 250mg, 100mg, 5g.
2,8-diiododibenzothiophene (CAS 105404-91-9) is a chemical compound with the molecular formula C12H6I2S and a molecular weight of 436.05 g/mol. IUPAC name: 2,8-diiododibenzothiophene. InChIKey: JUMCSMONVKDUIB-UHFFFAOYSA-N.
| Molecular formula | C12H6I2S |
|---|---|
| Molecular weight | 436.05 g/mol |
| IUPAC name | 2,8-diiododibenzothiophene |
| InChIKey | JUMCSMONVKDUIB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C3=C(S2)C=CC(=C3)I |
Computed by PubChem (NCBI)