CAS 105410-48-8 appears in our catalog under these names: 4-Hydroxy-2-methyl-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide 1,1-dioxide, 98%, Tenoxicam EP Impurity G, 4-Hydroxy-2-methyl- 1,1-dioxide-2H-thieno(2,3-e)-1,2-thiazine-3-carboxamide, >95% (HPLC), 4-Hydroxy-2-methyl-2H-thieno-(2,3-e)1,2-thiazine-3-carboxamide 1,1-Dioxide. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg.
4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxamide (CAS 105410-48-8) is a chemical compound with the molecular formula C8H8N2O4S2 and a molecular weight of 260.3 g/mol. IUPAC name: 4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxamide. InChIKey: NZKYGMSXZSNDRE-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4S2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 4-hydroxy-2-methyl-1,1-dioxothieno[2,3-e]thiazine-3-carboxamide |
| InChIKey | NZKYGMSXZSNDRE-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C2=C(S1(=O)=O)C=CS2)O)C(=O)N |
Computed by PubChem (NCBI)