CAS 10543-95-0 is the registry number for Hexafluoroacetone hydrate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g.
1,1,1,3,3,3-hexafluoropropan-2-one;hydrate (CAS 10543-95-0) is a chemical compound with the molecular formula C3H2F6O2 and a molecular weight of 184.04 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoropropan-2-one;hydrate. InChIKey: HEBNOKIGWWEWCN-UHFFFAOYSA-N.
| Molecular formula | C3H2F6O2 |
|---|---|
| Molecular weight | 184.04 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoropropan-2-one;hydrate |
| InChIKey | HEBNOKIGWWEWCN-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(F)F)C(F)(F)F.O |
Computed by PubChem (NCBI)