CAS 1054311-42-0 is the registry number for 3-(2-(4-Methoxyphenylamino)benzo(d)ozazol-5-yl)propanoic acid hcl, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-[2-(4-methoxyanilino)-1,3-benzoxazol-5-yl]propanoic acid;hydrochloride (CAS 1054311-42-0) is a chemical compound with the molecular formula C17H17ClN2O4 and a molecular weight of 348.8 g/mol. IUPAC name: 3-[2-(4-methoxyanilino)-1,3-benzoxazol-5-yl]propanoic acid;hydrochloride. InChIKey: SAAOHNXEOQBVFW-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2O4 |
|---|---|
| Molecular weight | 348.8 g/mol |
| IUPAC name | 3-[2-(4-methoxyanilino)-1,3-benzoxazol-5-yl]propanoic acid;hydrochloride |
| InChIKey | SAAOHNXEOQBVFW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=NC3=C(O2)C=CC(=C3)CCC(=O)O.Cl |
Computed by PubChem (NCBI)