Products 1054451-07-8
CAS 1054451-07-8 is the registry number for SMM-189. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone (CAS 1054451-07-8) is a chemical compound with the molecular formula C19H12Cl2O3 and a molecular weight of 359.2 g/mol. IUPAC name: [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone. InChIKey: CRNLOOZHRPDURJ-UHFFFAOYSA-N.
| Molecular formula | C19H12Cl2O3 |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | [4-(3,5-dichlorophenyl)-3,5-dihydroxyphenyl]-phenylmethanone |
| InChIKey | CRNLOOZHRPDURJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)O)C3=CC(=CC(=C3)Cl)Cl)O |
Computed by PubChem (NCBI)