CAS 105479-86-5 appears in our catalog under these names: Malonaldehyde-1,3-d2 Bis(diethyl Acetal), 96 atom % D, min 98% Chemical Purity, 1,1,3,3-Tetraethoxypropane-1,3-d2, >95% (GC), 1,1,3,3–Tetraethoxypropane–d2, 1,1,3,3-Tetraethoxypropane-d2, 99.23%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 50mg, 5mg, 1mg, 5 mg, 1 mg.
1,1,1,2,2-pentadeuterio-2-[tris(1,1,2,2,2-pentadeuterioethoxy)methoxy]ethane (CAS 105479-86-5) is a chemical compound with the molecular formula C9H20O4 and a molecular weight of 212.38 g/mol. IUPAC name: 1,1,1,2,2-pentadeuterio-2-[tris(1,1,2,2,2-pentadeuterioethoxy)methoxy]ethane. InChIKey: CWLNAJYDRSIKJS-DEHFLJNXSA-N.
| Molecular formula | C9H20O4 |
|---|---|
| Molecular weight | 212.38 g/mol |
| IUPAC name | 1,1,1,2,2-pentadeuterio-2-[tris(1,1,2,2,2-pentadeuterioethoxy)methoxy]ethane |
| InChIKey | CWLNAJYDRSIKJS-DEHFLJNXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(OC([2H])([2H])C([2H])([2H])[2H])(OC([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)