CAS 105479-87-6 is the registry number for Bis(1,3-dithian-2-yl)methane-d2. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-deuterio-2-[(2-deuterio-1,3-dithian-2-yl)methyl]-1,3-dithiane (CAS 105479-87-6) is a chemical compound with the molecular formula C9H16S4 and a molecular weight of 254.5 g/mol. IUPAC name: 2-deuterio-2-[(2-deuterio-1,3-dithian-2-yl)methyl]-1,3-dithiane. InChIKey: DCJKPLNHQJEQOL-XETGXLELSA-N.
| Molecular formula | C9H16S4 |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 2-deuterio-2-[(2-deuterio-1,3-dithian-2-yl)methyl]-1,3-dithiane |
| InChIKey | DCJKPLNHQJEQOL-XETGXLELSA-N |
| SMILES | [2H]C1(SCCCS1)CC2(SCCCS2)[2H] |
Computed by PubChem (NCBI)