CAS 10548-10-4 appears in our catalog under these names: Terbufos Sulfoxide, Terbufos-sulfoxide, >95% (HPLC), Terbufos-sulfoxide, TERBUFOS-SULFOXIDE PESTANAL, Terbufos-sulfoxide, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: on request, 100mg, 25mg, 50mg, 1x1ml, 1x50mg.
Tert-butylsulfinylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane (CAS 10548-10-4) is a chemical compound with the molecular formula C9H21O3PS3 and a molecular weight of 304.4 g/mol. IUPAC name: tert-butylsulfinylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane. InChIKey: KKOYBOFPUBHPFO-UHFFFAOYSA-N.
| Molecular formula | C9H21O3PS3 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tert-butylsulfinylmethylsulfanyl-diethoxy-sulfanylidene-lambda5-phosphane |
| InChIKey | KKOYBOFPUBHPFO-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCS(=O)C(C)(C)C |
Computed by PubChem (NCBI)