CAS 105481-68-3 is the registry number for 3-((3-methylphenyl)amino)-2-phenylinden-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(3-methylanilino)-2-phenylinden-1-one (CAS 105481-68-3) is a chemical compound with the molecular formula C22H17NO and a molecular weight of 311.4 g/mol. IUPAC name: 3-(3-methylanilino)-2-phenylinden-1-one. InChIKey: ORTIGEUGWLTSNM-UHFFFAOYSA-N.
| Molecular formula | C22H17NO |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 3-(3-methylanilino)-2-phenylinden-1-one |
| InChIKey | ORTIGEUGWLTSNM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=C(C(=O)C3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)