CAS 10558-44-8 is the registry number for Bis(2-thienyl) ketoxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(dithiophen-2-ylmethylidene)hydroxylamine (CAS 10558-44-8) is a chemical compound with the molecular formula C9H7NOS2 and a molecular weight of 209.3 g/mol. IUPAC name: N-(dithiophen-2-ylmethylidene)hydroxylamine. InChIKey: UXSSDPITEOFAMK-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS2 |
|---|---|
| Molecular weight | 209.3 g/mol |
| IUPAC name | N-(dithiophen-2-ylmethylidene)hydroxylamine |
| InChIKey | UXSSDPITEOFAMK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=NO)C2=CC=CS2 |
Computed by PubChem (NCBI)