CAS 105593-21-3 is the registry number for Gibberellin A72. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 5mg, 10mg, 25mg, 50mg.
5,7,12-trihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid (CAS 105593-21-3) is a chemical compound with the molecular formula C19H24O7 and a molecular weight of 364.4 g/mol. IUPAC name: 5,7,12-trihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid. InChIKey: SISDKGXXRJQNSE-UHFFFAOYSA-N.
| Molecular formula | C19H24O7 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 5,7,12-trihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| InChIKey | SISDKGXXRJQNSE-UHFFFAOYSA-N |
| SMILES | CC12C(CCC3(C1C(C45C3CCC(C4)(C(=C)C5O)O)C(=O)O)OC2=O)O |
Computed by PubChem (NCBI)