CAS 1055995-94-2 is the registry number for 4-Bromo-N,N-diethyl-2-(trifluoromethoxy)benzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-N,N-diethyl-2-(trifluoromethoxy)benzenesulfonamide (CAS 1055995-94-2) is a chemical compound with the molecular formula C11H13BrF3NO3S and a molecular weight of 376.19 g/mol. IUPAC name: 4-bromo-N,N-diethyl-2-(trifluoromethoxy)benzenesulfonamide. InChIKey: RHANIOYZJKABTE-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF3NO3S |
|---|---|
| Molecular weight | 376.19 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-2-(trifluoromethoxy)benzenesulfonamide |
| InChIKey | RHANIOYZJKABTE-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=C(C=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)