CAS 1056-08-2 appears in our catalog under these names: 21-Di(methylenebis(oxy)) 5Alpha-Dihydrocortisol, 21-Di(methylenebis(oxy)) 5a-Dihydrocortisol. Offered by: TRC. Available pack sizes: 1g, 500mg, 5g.
CAS 1056-08-2 identifies a chemical compound with the molecular formula C23H34O6 and a molecular weight of 406.5 g/mol. InChIKey: WMOCWGJGTDLMSA-SUYFMUOVSA-N.
| Molecular formula | C23H34O6 |
|---|---|
| Molecular weight | 406.5 g/mol |
| InChIKey | WMOCWGJGTDLMSA-SUYFMUOVSA-N |
| SMILES | C[C@]12CCC(=O)C[C@@H]1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@]45C6(COCO6)OCO5)C)O |
Computed by PubChem (NCBI)