CAS 105601-13-6 appears in our catalog under these names: 3-((1RS)-1-(Dimethylamino)ethyl)phenyl Dimethylcarbamate Hydrochloride, Rivastigmine Hydrogen Tartrate Impurity B (as Racemate Hydrochloride), 3-(1-(Dimethylamino)ethyl)phenyl dimethylcarbamate hydrochloride, 95%+, 95%+, 3-(1-(Dimethylamino)ethyl)phenyl dimethylcarbamate hydrochloride, 97%, 3-(1-(Dimethylamino)ethyl)phenyl dimethylcarbamate hydrochloride, 95%. Offered by: Mikromol, Chemat, Fluorochem, Ambeed. Available pack sizes: 4x25mg, 25mg, 100mg, 250mg, 1g, 5g.
[3-[1-(dimethylamino)ethyl]phenyl] N,N-dimethylcarbamate;hydrochloride (CAS 105601-13-6) is a chemical compound with the molecular formula C13H21ClN2O2 and a molecular weight of 272.77 g/mol. IUPAC name: [3-[1-(dimethylamino)ethyl]phenyl] N,N-dimethylcarbamate;hydrochloride. InChIKey: YWHWAUYZFYZSNE-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O2 |
|---|---|
| Molecular weight | 272.77 g/mol |
| IUPAC name | [3-[1-(dimethylamino)ethyl]phenyl] N,N-dimethylcarbamate;hydrochloride |
| InChIKey | YWHWAUYZFYZSNE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)OC(=O)N(C)C)N(C)C.Cl |
Computed by PubChem (NCBI)