Products 105601-14-7
CAS 105601-14-7 is the registry number for rac-Rivastigmine HCl. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate;hydrochloride (CAS 105601-14-7) is a chemical compound with the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. IUPAC name: [3-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate;hydrochloride. InChIKey: MWZZKXHKVSEKKP-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O2 |
|---|---|
| Molecular weight | 286.80 g/mol |
| IUPAC name | [3-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate;hydrochloride |
| InChIKey | MWZZKXHKVSEKKP-UHFFFAOYSA-N |
| SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)C(C)N(C)C.Cl |
Computed by PubChem (NCBI)