Products 1056027-43-0
CAS 1056027-43-0 is the registry number for (S)-3-(4-Bromophenoxy)propane-1,2-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-(4-bromophenoxy)propane-1,2-diol (CAS 1056027-43-0) is a chemical compound with the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. IUPAC name: (2S)-3-(4-bromophenoxy)propane-1,2-diol. InChIKey: FZGZDDRZAZBANV-QMMMGPOBSA-N.
| Molecular formula | C9H11BrO3 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | (2S)-3-(4-bromophenoxy)propane-1,2-diol |
| InChIKey | FZGZDDRZAZBANV-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1OC[C@H](CO)O)Br |
Computed by PubChem (NCBI)