CAS 1056188-47-6 appears in our catalog under these names: Ezetimibe Impurity 90, 5-(4-fluorophenyl)-5-oxopentanoic pivalic anhydride, Ezetimibe Impurity 86. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,2-dimethylpropanoyl 5-(4-fluorophenyl)-5-oxopentanoate (CAS 1056188-47-6) is a chemical compound with the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. IUPAC name: 2,2-dimethylpropanoyl 5-(4-fluorophenyl)-5-oxopentanoate. InChIKey: ATBBBXPJDZIEQR-UHFFFAOYSA-N.
| Molecular formula | C16H19FO4 |
|---|---|
| Molecular weight | 294.32 g/mol |
| IUPAC name | 2,2-dimethylpropanoyl 5-(4-fluorophenyl)-5-oxopentanoate |
| InChIKey | ATBBBXPJDZIEQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC(=O)CCCC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)