CAS 1056471-60-3 is the registry number for 3-Hydroxypyrrolidine-1-carboxamidine sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-hydroxypyrrolidine-1-carboximidamide;sulfuric acid (CAS 1056471-60-3) is a chemical compound with the molecular formula C5H13N3O5S and a molecular weight of 227.24 g/mol. IUPAC name: 3-hydroxypyrrolidine-1-carboximidamide;sulfuric acid. InChIKey: QPRWINJOTBLPTM-UHFFFAOYSA-N.
| Molecular formula | C5H13N3O5S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 3-hydroxypyrrolidine-1-carboximidamide;sulfuric acid |
| InChIKey | QPRWINJOTBLPTM-UHFFFAOYSA-N |
| SMILES | C1CN(CC1O)C(=N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)