CAS 1056475-66-1 appears in our catalog under these names: 3-Methylsulfinylphenylboronic acid, 95%, (3-(Methylsulfinyl)phenyl)boronic acid 95%, (3-(Methylsulfinyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(3-methylsulfinylphenyl)boronic acid (CAS 1056475-66-1) is a chemical compound with the molecular formula C7H9BO3S and a molecular weight of 184.03 g/mol. IUPAC name: (3-methylsulfinylphenyl)boronic acid. InChIKey: XYLPYIANRLXCDW-UHFFFAOYSA-N.
| Molecular formula | C7H9BO3S |
|---|---|
| Molecular weight | 184.03 g/mol |
| IUPAC name | (3-methylsulfinylphenyl)boronic acid |
| InChIKey | XYLPYIANRLXCDW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)C)(O)O |
Computed by PubChem (NCBI)