CAS 105650-34-8 appears in our catalog under these names: 5-Formyl-2-methylbenzoic acid, 98%, 5-Formyl-2-methylbenzoic acid, 5-Formyl-2-methylbenzoic acid 95%, 5-Formyl-2-methylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
5-formyl-2-methylbenzoic acid (CAS 105650-34-8) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 5-formyl-2-methylbenzoic acid. InChIKey: MVVDVVGJOWHJMU-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 5-formyl-2-methylbenzoic acid |
| InChIKey | MVVDVVGJOWHJMU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C=O)C(=O)O |
Computed by PubChem (NCBI)