CAS 1056678-67-1 is the registry number for Pentanamide, 2-amino-n-[(4-fluorophenyl)methyl]-3-methyl-, (2s,3s)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S,3S)-2-amino-N-[(4-fluorophenyl)methyl]-3-methylpentanamide (CAS 1056678-67-1) is a chemical compound with the molecular formula C13H19FN2O and a molecular weight of 238.30 g/mol. IUPAC name: (2S,3S)-2-amino-N-[(4-fluorophenyl)methyl]-3-methylpentanamide. InChIKey: MKESPQQAONQWRL-CABZTGNLSA-N.
| Molecular formula | C13H19FN2O |
|---|---|
| Molecular weight | 238.30 g/mol |
| IUPAC name | (2S,3S)-2-amino-N-[(4-fluorophenyl)methyl]-3-methylpentanamide |
| InChIKey | MKESPQQAONQWRL-CABZTGNLSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NCC1=CC=C(C=C1)F)N |
Computed by PubChem (NCBI)