CAS 10567-73-4 is the registry number for O-Mono-2,4-DNP-L-tyrosine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-amino-3-[4-(2,4-dinitrophenoxy)phenyl]propanoic acid (CAS 10567-73-4) is a chemical compound with the molecular formula C15H13N3O7 and a molecular weight of 347.28 g/mol. IUPAC name: 2-amino-3-[4-(2,4-dinitrophenoxy)phenyl]propanoic acid. InChIKey: OHFDOVYRFJQGIR-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O7 |
|---|---|
| Molecular weight | 347.28 g/mol |
| IUPAC name | 2-amino-3-[4-(2,4-dinitrophenoxy)phenyl]propanoic acid |
| InChIKey | OHFDOVYRFJQGIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)OC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)