CAS 105704-32-3 appears in our catalog under these names: 6-(Chloromethyl)-n-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine, 95%, 6-(Chloromethyl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g.
6-(chloromethyl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (CAS 105704-32-3) is a chemical compound with the molecular formula C10H9ClFN5 and a molecular weight of 253.66 g/mol. IUPAC name: 6-(chloromethyl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: ZEIVACZLRBMZJI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFN5 |
|---|---|
| Molecular weight | 253.66 g/mol |
| IUPAC name | 6-(chloromethyl)-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | ZEIVACZLRBMZJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC(=N2)N)CCl)F |
Computed by PubChem (NCBI)