Products 1057138-89-2
CAS 1057138-89-2 appears in our catalog under these names: Acrivastine Impurity 2, Acrivastine Impurity 5, Acrivastine Isomer Z. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(E)-3-[6-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enoic acid (CAS 1057138-89-2) is a chemical compound with the molecular formula C22H24N2O2 and a molecular weight of 348.4 g/mol. IUPAC name: (E)-3-[6-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enoic acid. InChIKey: PWACSDKDOHSSQD-MUUKASMTSA-N.
| Molecular formula | C22H24N2O2 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (E)-3-[6-[(Z)-1-(4-methylphenyl)-3-pyrrolidin-1-ylprop-1-enyl]-2-pyridinyl]prop-2-enoic acid |
| InChIKey | PWACSDKDOHSSQD-MUUKASMTSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=C/CN2CCCC2)/C3=CC=CC(=N3)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Acrivastine Impurity 2, Acrivastine isomer Z