CAS 105735-86-2 appears in our catalog under these names: Rel-2-amino-3,5-dibromo-N-((1r,4r)-4-hydroxycyclohexyl)benzamide, 98%, Ambroxol Impurity 19. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-3,5-dibromo-N-(4-hydroxycyclohexyl)benzamide (CAS 105735-86-2) is a chemical compound with the molecular formula C13H16Br2N2O2 and a molecular weight of 392.09 g/mol. IUPAC name: 2-amino-3,5-dibromo-N-(4-hydroxycyclohexyl)benzamide. InChIKey: KZPJIHCQAQVARH-UHFFFAOYSA-N.
| Molecular formula | C13H16Br2N2O2 |
|---|---|
| Molecular weight | 392.09 g/mol |
| IUPAC name | 2-amino-3,5-dibromo-N-(4-hydroxycyclohexyl)benzamide |
| InChIKey | KZPJIHCQAQVARH-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NC(=O)C2=C(C(=CC(=C2)Br)Br)N)O |
Computed by PubChem (NCBI)