CAS 1057654-43-9 appears in our catalog under these names: 3,5-Dimethylbiphenyl-4-ylboronic acid, 95%, (3,5-Dimethyl-[1,1'-biphenyl]-4-yl)boronic acid, ≥98.2%, ≥98.2%, 3,5-Dimethylbiphenyl-4-ylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(2,6-dimethyl-4-phenylphenyl)boronic acid (CAS 1057654-43-9) is a chemical compound with the molecular formula C14H15BO2 and a molecular weight of 226.08 g/mol. IUPAC name: (2,6-dimethyl-4-phenylphenyl)boronic acid. InChIKey: KEWCSCZDKPGJSC-UHFFFAOYSA-N.
| Molecular formula | C14H15BO2 |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | (2,6-dimethyl-4-phenylphenyl)boronic acid |
| InChIKey | KEWCSCZDKPGJSC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)