Products 1057654-43-9

CAS 1057654-43-9 appears in our catalog under these names: 3,5-Dimethylbiphenyl-4-ylboronic acid, 95%, (3,5-Dimethyl-[1,1'-biphenyl]-4-yl)boronic acid, ≥98.2%, ≥98.2%, 3,5-Dimethylbiphenyl-4-ylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,6-dimethyl-4-phenylphenyl)boronic acid (CAS 1057654-43-9) is a chemical compound with the molecular formula C14H15BO2 and a molecular weight of 226.08 g/mol. IUPAC name: (2,6-dimethyl-4-phenylphenyl)boronic acid. InChIKey: KEWCSCZDKPGJSC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15BO2
Molecular weight226.08 g/mol
IUPAC name(2,6-dimethyl-4-phenylphenyl)boronic acid
InChIKeyKEWCSCZDKPGJSC-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1C)C2=CC=CC=C2)C)(O)O

Computed by PubChem (NCBI)