CAS 105813-04-5 is the registry number for cis-(-)-Paroxetine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
(3R,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine;hydrochloride (CAS 105813-04-5) is a chemical compound with the molecular formula C19H21ClFNO3 and a molecular weight of 365.8 g/mol. IUPAC name: (3R,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine;hydrochloride. InChIKey: GELRVIPPMNMYGS-CVLQQERVSA-N.
| Molecular formula | C19H21ClFNO3 |
|---|---|
| Molecular weight | 365.8 g/mol |
| IUPAC name | (3R,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine;hydrochloride |
| InChIKey | GELRVIPPMNMYGS-CVLQQERVSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1C2=CC=C(C=C2)F)COC3=CC4=C(C=C3)OCO4.Cl |
Computed by PubChem (NCBI)