Products 105813-07-8

CAS 105813-07-8 is the registry number for Paroxetine Impurity 46. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(3S,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine (CAS 105813-07-8) is a chemical compound with the molecular formula C19H20FNO3 and a molecular weight of 329.4 g/mol. IUPAC name: (3S,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine. InChIKey: AHOUBRCZNHFOSL-WMLDXEAASA-N.

Identity
Molecular formulaC19H20FNO3
Molecular weight329.4 g/mol
IUPAC name(3S,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine
InChIKeyAHOUBRCZNHFOSL-WMLDXEAASA-N
SMILESC1CNC[C@H]([C@H]1C2=CC=C(C=C2)F)COC3=CC4=C(C=C3)OCO4

Computed by PubChem (NCBI)