CAS 105813-07-8 is the registry number for Paroxetine Impurity 46. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(3S,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine (CAS 105813-07-8) is a chemical compound with the molecular formula C19H20FNO3 and a molecular weight of 329.4 g/mol. IUPAC name: (3S,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine. InChIKey: AHOUBRCZNHFOSL-WMLDXEAASA-N.
| Molecular formula | C19H20FNO3 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (3S,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine |
| InChIKey | AHOUBRCZNHFOSL-WMLDXEAASA-N |
| SMILES | C1CNC[C@H]([C@H]1C2=CC=C(C=C2)F)COC3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)