CAS 1058156-90-3 appears in our catalog under these names: Anlotinib, Anlotinib free base. Offered by: Chemat Brand, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 100mg, 1g, 200mg, 25mg, 5mg, 50mg.
1-[[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinolin-7-yl]oxymethyl]cyclopropan-1-amine (CAS 1058156-90-3) is a chemical compound with the molecular formula C23H22FN3O3 and a molecular weight of 407.4 g/mol. IUPAC name: 1-[[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinolin-7-yl]oxymethyl]cyclopropan-1-amine. InChIKey: KSMZEXLVHXZPEF-UHFFFAOYSA-N.
| Molecular formula | C23H22FN3O3 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | 1-[[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxyquinolin-7-yl]oxymethyl]cyclopropan-1-amine |
| InChIKey | KSMZEXLVHXZPEF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=C2F)OC3=C4C=C(C(=CC4=NC=C3)OCC5(CC5)N)OC |
Computed by PubChem (NCBI)