CAS 10584-98-2 appears in our catalog under these names: Bis(2-ethylhexyl) 2,2'-((dibutylstannanediyl)bis(sulfanediyl))diacetate, 98%, 98%, Dibutyltin bis(2-ethylhexyl mercaptoacetate), Dibutyltin bis(2-ethylhexyl mercaptoacetate)-d34, Dibutyltin bis(2-ethylhexyl mercaptoacetate)-d4. Offered by: Chemat, Chemat Brand, HPC Standards. Available pack sizes: 100mg, 250mg, 1g, 5g, on request, 1x50mg.
2-ethylhexyl 2-[dibutyl-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylstannyl]sulfanylacetate (CAS 10584-98-2) is a chemical compound with the molecular formula C28H56O4S2Sn and a molecular weight of 639.6 g/mol. IUPAC name: 2-ethylhexyl 2-[dibutyl-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylstannyl]sulfanylacetate. InChIKey: PRIUALOJYOZZOJ-UHFFFAOYSA-L.
| Molecular formula | C28H56O4S2Sn |
|---|---|
| Molecular weight | 639.6 g/mol |
| IUPAC name | 2-ethylhexyl 2-[dibutyl-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylstannyl]sulfanylacetate |
| InChIKey | PRIUALOJYOZZOJ-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)COC(=O)CS[Sn](CCCC)(CCCC)SCC(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)