Products 1058713-16-8

CAS 1058713-16-8 is the registry number for Ethyl 5-(chlorosulfonyl)-2,3-dihydro-1-benzofuran-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate (CAS 1058713-16-8) is a chemical compound with the molecular formula C11H11ClO5S and a molecular weight of 290.72 g/mol. IUPAC name: ethyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate. InChIKey: VEEPMWPOOQQMAE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO5S
Molecular weight290.72 g/mol
IUPAC nameethyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate
InChIKeyVEEPMWPOOQQMAE-UHFFFAOYSA-N
SMILESCCOC(=O)C1CC2=C(O1)C=CC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)