CAS 1058713-16-8 is the registry number for Ethyl 5-(chlorosulfonyl)-2,3-dihydro-1-benzofuran-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate (CAS 1058713-16-8) is a chemical compound with the molecular formula C11H11ClO5S and a molecular weight of 290.72 g/mol. IUPAC name: ethyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate. InChIKey: VEEPMWPOOQQMAE-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO5S |
|---|---|
| Molecular weight | 290.72 g/mol |
| IUPAC name | ethyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate |
| InChIKey | VEEPMWPOOQQMAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(O1)C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)