CAS 10589-94-3 appears in our catalog under these names: Pyroporphyrin dimethyl ester, 95%, Deuteroporphyrin dimethyl ester, Deuteroporphyrin 1X dimethyl ester, DEUTEROPORPHYRIN IX DIMETHYL ESTER, &, Pyroporphyrindimethylester. Offered by: Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 100mg, 10mg, 50mg, 500mg, 1000mg, 100 mg.
Methyl 3-[18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate (CAS 10589-94-3) is a chemical compound with the molecular formula C32H34N4O4 and a molecular weight of 538.6 g/mol. IUPAC name: methyl 3-[18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate. InChIKey: CEPCOHFDZYMQHP-UHFFFAOYSA-N.
| Molecular formula | C32H34N4O4 |
|---|---|
| Molecular weight | 538.6 g/mol |
| IUPAC name | methyl 3-[18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |
| InChIKey | CEPCOHFDZYMQHP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC3=C(C=C(N3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1N2)C)CCC(=O)OC)CCC(=O)OC)C)C |
Computed by PubChem (NCBI)