CAS 105931-44-0 appears in our catalog under these names: D-Xylulose 5-Phosphate Sodium Salt, (2R,3S)-2,3,5-Trihydroxy-4-oxopentyl dihydrogen phosphate, sodium salt, 90%, 90%, D-Xylulose 5-phosphate (sodium), 90.0%. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 5 mg, 10 mg, 1 mg.
Sodium [(2R,3S)-2,3,5-trihydroxy-4-oxopentyl] hydrogen phosphate (CAS 105931-44-0) is a chemical compound with the molecular formula C5H10NaO8P and a molecular weight of 252.09 g/mol. IUPAC name: sodium [(2R,3S)-2,3,5-trihydroxy-4-oxopentyl] hydrogen phosphate. InChIKey: OVHWWORCLJVDMI-TYSVMGFPSA-M.
| Molecular formula | C5H10NaO8P |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | sodium [(2R,3S)-2,3,5-trihydroxy-4-oxopentyl] hydrogen phosphate |
| InChIKey | OVHWWORCLJVDMI-TYSVMGFPSA-M |
| SMILES | C([C@H]([C@@H](C(=O)CO)O)O)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)