CAS 1059677-40-5 appears in our catalog under these names: (2-([1,1':4',1''-Terphenyl]-3-yl)-1-hydroxyethane-1,1-diyl)diphosphonic acid, 97%, BPH-628. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
[1-hydroxy-2-[3-(4-phenylphenyl)phenyl]-1-phosphonoethyl]phosphonic acid (CAS 1059677-40-5) is a chemical compound with the molecular formula C20H20O7P2 and a molecular weight of 434.3 g/mol. IUPAC name: [1-hydroxy-2-[3-(4-phenylphenyl)phenyl]-1-phosphonoethyl]phosphonic acid. InChIKey: MPBUFKZCEBTBSK-UHFFFAOYSA-N.
| Molecular formula | C20H20O7P2 |
|---|---|
| Molecular weight | 434.3 g/mol |
| IUPAC name | [1-hydroxy-2-[3-(4-phenylphenyl)phenyl]-1-phosphonoethyl]phosphonic acid |
| InChIKey | MPBUFKZCEBTBSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC(=C3)CC(O)(P(=O)(O)O)P(=O)(O)O |
Computed by PubChem (NCBI)