CAS 1059734-66-5 appears in our catalog under these names: BMS–833923, BMS 833923, BMS-833923/ 99.61% (existing batch purity), BMS-833923, BMS-833923 98%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 100mg, 25mg, 10mg, 50mg, 200mg, 10mM (in 1ml dmso), 250mg.
N-[2-methyl-5-(methylaminomethyl)phenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide (CAS 1059734-66-5) is a chemical compound with the molecular formula C30H27N5O and a molecular weight of 473.6 g/mol. IUPAC name: N-[2-methyl-5-(methylaminomethyl)phenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide. InChIKey: KLRRGBHZCJLIEL-UHFFFAOYSA-N.
| Molecular formula | C30H27N5O |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | N-[2-methyl-5-(methylaminomethyl)phenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide |
| InChIKey | KLRRGBHZCJLIEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CNC)NC(=O)C2=CC=C(C=C2)NC3=NC4=CC=CC=C4C(=N3)C5=CC=CC=C5 |
Computed by PubChem (NCBI)