CAS 10598-87-5 is the registry number for (E)–Ethyl 2–(1–Carbamoyl–2–((5–Nitrofuran–2–Yl)Methylene)Hydrazinyl)Acetate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 2-[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]amino]acetate (CAS 10598-87-5) is a chemical compound with the molecular formula C10H12N4O6 and a molecular weight of 284.23 g/mol. IUPAC name: ethyl 2-[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]amino]acetate. InChIKey: ONHUPCAVZVIYFY-LFYBBSHMSA-N.
| Molecular formula | C10H12N4O6 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | ethyl 2-[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]amino]acetate |
| InChIKey | ONHUPCAVZVIYFY-LFYBBSHMSA-N |
| SMILES | CCOC(=O)CN(C(=O)N)/N=C/C1=CC=C(O1)[N+](=O)[O-] |
Computed by PubChem (NCBI)