Products 106004-06-2

CAS 106004-06-2 is the registry number for Dimethyl 1-(2-chloroethyl)cyclohexane-1,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Dimethyl 1-(2-chloroethyl)cyclohexane-1,4-dicarboxylate (CAS 106004-06-2) is a chemical compound with the molecular formula C12H19ClO4 and a molecular weight of 262.73 g/mol. IUPAC name: dimethyl 1-(2-chloroethyl)cyclohexane-1,4-dicarboxylate. InChIKey: ONBAUDQPYATDMN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19ClO4
Molecular weight262.73 g/mol
IUPAC namedimethyl 1-(2-chloroethyl)cyclohexane-1,4-dicarboxylate
InChIKeyONBAUDQPYATDMN-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(CC1)(CCCl)C(=O)OC

Computed by PubChem (NCBI)