CAS 106032-59-1 is the registry number for Cyclohexanaminium (1R,2S,3R,4R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl phosphate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclohexanamine;[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate (CAS 106032-59-1) is a chemical compound with the molecular formula C12H26NO9P and a molecular weight of 359.31 g/mol. IUPAC name: cyclohexanamine;[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate. InChIKey: CIDVDWGHBSYGCB-MDRKMWFQSA-N.
| Molecular formula | C12H26NO9P |
|---|---|
| Molecular weight | 359.31 g/mol |
| IUPAC name | cyclohexanamine;[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] dihydrogen phosphate |
| InChIKey | CIDVDWGHBSYGCB-MDRKMWFQSA-N |
| SMILES | C1CCC(CC1)N.[C@H]1([C@H](C([C@@H]([C@@H](C1O)O)O)OP(=O)(O)O)O)O |
Computed by PubChem (NCBI)