Products 106050-84-4
CAS 106050-84-4 is the registry number for Hoechst 33342 analog 2, 98.60%. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-iodo-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol (CAS 106050-84-4) is a chemical compound with the molecular formula C25H23IN6O and a molecular weight of 550.4 g/mol. IUPAC name: 2-iodo-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol. InChIKey: ZGUNSONXLSTYPT-UHFFFAOYSA-N.
| Molecular formula | C25H23IN6O |
|---|---|
| Molecular weight | 550.4 g/mol |
| IUPAC name | 2-iodo-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol |
| InChIKey | ZGUNSONXLSTYPT-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC(=C(C=C6)O)I |
Computed by PubChem (NCBI)