CAS 1060735-19-4 appears in our catalog under these names: 9,9''-Diphenyl-9h,9'h,9''h-3,3':6',3''-tercarbazole, 95%, 9,9''–Diphenyl–9H,9'H,9''H–3,3':6',3''–tercarbazole, 9,9''-Diphenyl-9H,9'H,9''H-3,3':6',3''-tercarbazole. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g.
3,6-bis(9-phenylcarbazol-3-yl)-9H-carbazole (CAS 1060735-19-4) is a chemical compound with the molecular formula C48H31N3 and a molecular weight of 649.8 g/mol. IUPAC name: 3,6-bis(9-phenylcarbazol-3-yl)-9H-carbazole. InChIKey: WHNXOCRGAXKSKD-UHFFFAOYSA-N.
| Molecular formula | C48H31N3 |
|---|---|
| Molecular weight | 649.8 g/mol |
| IUPAC name | 3,6-bis(9-phenylcarbazol-3-yl)-9H-carbazole |
| InChIKey | WHNXOCRGAXKSKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC5=C(C=C4)NC6=C5C=C(C=C6)C7=CC8=C(C=C7)N(C9=CC=CC=C98)C1=CC=CC=C1)C1=CC=CC=C12 |
Computed by PubChem (NCBI)