Products 1061377-99-8
CAS 1061377-99-8 is the registry number for sEH-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenoxy]benzoic acid (CAS 1061377-99-8) is a chemical compound with the molecular formula C21H15F3N2O5 and a molecular weight of 432.3 g/mol. IUPAC name: 4-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenoxy]benzoic acid. InChIKey: CLWASWNEAHTOFE-UHFFFAOYSA-N.
| Molecular formula | C21H15F3N2O5 |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | 4-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenoxy]benzoic acid |
| InChIKey | CLWASWNEAHTOFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)NC(=O)NC3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)