CAS 106209-21-6 is the registry number for 1-(Heptadecafluorooct-1-yl)-4-vinylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-ethenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)benzene (CAS 106209-21-6) is a chemical compound with the molecular formula C16H7F17 and a molecular weight of 522.20 g/mol. IUPAC name: 1-ethenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)benzene. InChIKey: DBTAMHSPOTZDDY-UHFFFAOYSA-N.
| Molecular formula | C16H7F17 |
|---|---|
| Molecular weight | 522.20 g/mol |
| IUPAC name | 1-ethenyl-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)benzene |
| InChIKey | DBTAMHSPOTZDDY-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)