CAS 106224-36-6 appears in our catalog under these names: Palladium(II) trimethylacetate, 95%, Palladium(II) trimethylacetate , Palladium(II) pivalate 98%, PALLADIUM PIVALATE, 97%, Palladium pivalate, 98%, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 500MG.
Bis(2,2-dimethylpropanoate);palladium(2+) (CAS 106224-36-6) is a chemical compound with the molecular formula C10H18O4Pd and a molecular weight of 308.67 g/mol. IUPAC name: bis(2,2-dimethylpropanoate);palladium(2+). InChIKey: PAGZTSLSNQZYEV-UHFFFAOYSA-L.
| Molecular formula | C10H18O4Pd |
|---|---|
| Molecular weight | 308.67 g/mol |
| IUPAC name | bis(2,2-dimethylpropanoate);palladium(2+) |
| InChIKey | PAGZTSLSNQZYEV-UHFFFAOYSA-L |
| SMILES | CC(C)(C)C(=O)[O-].CC(C)(C)C(=O)[O-].[Pd+2] |
Computed by PubChem (NCBI)