CAS 106224-67-3 is the registry number for NC-182. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 6-[2-(dimethylamino)ethylcarbamoyl]-5-hydroxy-10-methoxybenzo[a]phenazine-9-carboxylate (CAS 106224-67-3) is a chemical compound with the molecular formula C24H24N4O5 and a molecular weight of 448.5 g/mol. IUPAC name: methyl 6-[2-(dimethylamino)ethylcarbamoyl]-5-hydroxy-10-methoxybenzo[a]phenazine-9-carboxylate. InChIKey: DGSXFRJEHFETBL-UHFFFAOYSA-N.
| Molecular formula | C24H24N4O5 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | methyl 6-[2-(dimethylamino)ethylcarbamoyl]-5-hydroxy-10-methoxybenzo[a]phenazine-9-carboxylate |
| InChIKey | DGSXFRJEHFETBL-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)C1=C(C2=CC=CC=C2C3=NC4=C(C=C(C(=C4)OC)C(=O)OC)N=C13)O |
Computed by PubChem (NCBI)