CAS 106232-39-7 appears in our catalog under these names: 4-(Methylsulfonyl)-1H-pyrazol-5-amine hydrochloride, 98%, 4-Methanesulfonyl-1H-pyrazol-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-methylsulfonyl-1H-pyrazol-5-amine;hydrochloride (CAS 106232-39-7) is a chemical compound with the molecular formula C4H8ClN3O2S and a molecular weight of 197.64 g/mol. IUPAC name: 4-methylsulfonyl-1H-pyrazol-5-amine;hydrochloride. InChIKey: OAAXWOPCVWKMRC-UHFFFAOYSA-N.
| Molecular formula | C4H8ClN3O2S |
|---|---|
| Molecular weight | 197.64 g/mol |
| IUPAC name | 4-methylsulfonyl-1H-pyrazol-5-amine;hydrochloride |
| InChIKey | OAAXWOPCVWKMRC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(NN=C1)N.Cl |
Computed by PubChem (NCBI)