CAS 106241-40-1 is the registry number for Bis((3,4-dichlorophenyl)thio)methane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene (CAS 106241-40-1) is a chemical compound with the molecular formula C13H8Cl4S2 and a molecular weight of 370.1 g/mol. IUPAC name: 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene. InChIKey: PVURINFQLWSBRK-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl4S2 |
|---|---|
| Molecular weight | 370.1 g/mol |
| IUPAC name | 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene |
| InChIKey | PVURINFQLWSBRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SCSC2=CC(=C(C=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)